dipropyl butanedioate


butanedioic acid, dipropyl ester; dipropyl butanedioate; di-n-propyl succinate; dipropyl succinate; n-propyl succinate; propyl succinate; succinic acid di-n-propyl ester
CAS RN:[925-15-5]
Formula:C10H18O4; 202.25 g/mol
InChiKey:SZHZCPHKDJWHNG-UHFFFAOYSA-N
SMILES:CCCOC(=O)CCC(=O)OCCC
Molecular structure of dipropyl butanedioate
Density:1.002 g/mL
Molar volume:201.9 mL/mol
Refractive index:1.425
Molecular refractive power:51.64 mL/mol
Melting point:-6 °C
Boiling point:251 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
Surface tension:31.05 dyn/cm
Log10 partition octanol / water:2.16

Isomers

6-acetyloxyhexyl acetate
Molecular structure of 6-acetyloxyhexyl acetate
3-butylhexanedioic acid
Molecular structure of 3-butylhexanedioic acid
decanedioic acid
Molecular structure of decanedioic acid
di-tert-butyl oxalate
Molecular structure of di-tert-butyl oxalate
dibutyl oxalate
Molecular structure of dibutyl oxalate
diethyl (R*,R*)-2,3-dimethylbutanedioate
Molecular structure of diethyl (R*,R*)-2,3-dimethylbutanedioate
diethyl 2,2-dimethylbutanedioate
Molecular structure of diethyl 2,2-dimethylbutanedioate
diethyl (R,S)-2,3-dimethylbutanedioate
Molecular structure of diethyl (R,S)-2,3-dimethylbutanedioate
diethyl ethylmethylpropanedioate
Molecular structure of diethyl ethylmethylpropanedioate
diethyl hexanedioate
Molecular structure of diethyl hexanedioate
diethyl isopropylmalonate
Molecular structure of diethyl isopropylmalonate
diethyl 2-propylpropanedioate
Molecular structure of diethyl 2-propylpropanedioate
diisobutyl oxalate
Molecular structure of diisobutyl oxalate
diisopropyl butanedioate
Molecular structure of diisopropyl butanedioate
dimethyl 2,3-diethylbutanedioate
Molecular structure of dimethyl 2,3-diethylbutanedioate
dimethyl (R,S)-2,3-diethylsuccinate
Molecular structure of dimethyl (R,S)-2,3-diethylsuccinate
dimethyl 3-ethyl-3-methylpentanedioate
Molecular structure of dimethyl 3-ethyl-3-methylpentanedioate
dimethyl 3,3-hexanedicarboxylate
Molecular structure of dimethyl 3,3-hexanedicarboxylate
dimethyl 2-pentylpropanedioate
Molecular structure of dimethyl 2-pentylpropanedioate
dipropyl butanedioate
Molecular structure of dipropyl butanedioate
dipropyl 2-methylpropanedioate
Molecular structure of dipropyl 2-methylpropanedioate
1,2-ethanediyl dibutanoate
Molecular structure of 1,2-ethanediyl dibutanoate
3-ethyl-3-propylpentanedioic acid
Molecular structure of 3-ethyl-3-propylpentanedioic acid
heptylpropanedioic acid
Molecular structure of heptylpropanedioic acid
methyl hydrogen azelate
Molecular structure of methyl hydrogen azelate
2-methyl-5-(1-methylethyl)hexanedioic acid
Molecular structure of 2-methyl-5-(1-methylethyl)hexanedioic acid
2-propyl-3,3-dimethylpentandioic acid
Molecular structure of 2-propyl-3,3-dimethylpentandioic acid
2,2,3-triethylbutanedioic acid
Molecular structure of 2,2,3-triethylbutanedioic acid
triethyleneglycol divinyl ether
Molecular structure of triethyleneglycol divinyl ether